C20H34O5 — CID 122184650
2-[(1R,2R,4aR,8S,8aS)-2,4a,8-trihydroxy-2,5,5,8a-tetramethyl-1,3,4,6,7,8-hexahydronaphthalen-1-yl]-1-[(2S,3R)-2,3-dimethyloxiran-2-yl]ethanone (PubChem CID 122184650) has the molecular formula C20H34O5 and a molecular weight of 354.49 g/mol. Its IUPAC name is 2-[(1R,2R,4aR,8S,8aS)-2,4a,8-trihydroxy-2,5,5,8a-tetramethyl-1,3,4,6,7,8-hexahydronaphthalen-1-yl]-1-[(2S,3R)-2,3-dimethyloxiran-2-yl]ethanone.
| Compound Name | 2-[(1R,2R,4aR,8S,8aS)-2,4a,8-trihydroxy-2,5,5,8a-tetramethyl-1,3,4,6,7,8-hexahydronaphthalen-1-yl]-1-[(2S,3R)-2,3-dimethyloxiran-2-yl]ethanone |
|---|---|
| PubChem CID | 122184650 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 2-[(1R,2R,4aR,8S,8aS)-2,4a,8-trihydroxy-2,5,5,8a-tetramethyl-1,3,4,6,7,8-hexahydronaphthalen-1-yl]-1-[(2S,3R)-2,3-dimethyloxiran-2-yl]ethanone |
| SMILES | C[C@H]1O[C@]1(C)C(=O)C[C@@H]1[C@@]2(C)[C@@H](O)CCC(C)(C)[C@]2(O)CC[C@@]1(C)O |
| InChI | InChI=1S/C20H34O5/c1-12-19(6,25-12)15(22)11-13-17(4,23)9-10-20(24)16(2,3)8-7-14(21)18(13,20)5/h12-14,21,23-24H,7-11H2,1-6H3/t12-,13+,14+,17-,18+,19+,20-/m1/s1 |
| InChIKey | IYXYEOGFUBDIEI-USEDJYDSSA-N |
| XLogP | 2.20 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|