C20H32O4 — CID 122184604
3-[(2R,3aR,5aR,9S,9aS,9bR)-5a,9-dihydroxy-3a,6,6,9a-tetramethyl-1,2,4,5,7,8,9,9b-octahydrobenzo[e][1]benzofuran-2-yl]but-3-en-2-one (PubChem CID 122184604) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is 3-[(2R,3aR,5aR,9S,9aS,9bR)-5a,9-dihydroxy-3a,6,6,9a-tetramethyl-1,2,4,5,7,8,9,9b-octahydrobenzo[e][1]benzofuran-2-yl]but-3-en-2-one.
| Compound Name | 3-[(2R,3aR,5aR,9S,9aS,9bR)-5a,9-dihydroxy-3a,6,6,9a-tetramethyl-1,2,4,5,7,8,9,9b-octahydrobenzo[e][1]benzofuran-2-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 122184604 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 3-[(2R,3aR,5aR,9S,9aS,9bR)-5a,9-dihydroxy-3a,6,6,9a-tetramethyl-1,2,4,5,7,8,9,9b-octahydrobenzo[e][1]benzofuran-2-yl]but-3-en-2-one |
| SMILES | C=C(C(C)=O)[C@H]1C[C@@H]2[C@@]3(C)[C@@H](O)CCC(C)(C)[C@]3(O)CC[C@@]2(C)O1 |
| InChI | InChI=1S/C20H32O4/c1-12(13(2)21)14-11-15-18(5,24-14)9-10-20(23)17(3,4)8-7-16(22)19(15,20)6/h14-16,22-23H,1,7-11H2,2-6H3/t14-,15+,16+,18-,19+,20-/m1/s1 |
| InChIKey | MTZHGGSCKVDXDP-JSQCUCEHSA-N |
| XLogP | 3.01 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|