C21H34AcO6 — CID 59085397
(4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-5,6,10,10b-tetrahydroxy-3,4a,6a,7,7,10a-hexamethyl-2,5,6,8,9,10-hexahydrobenzo[f]chromen-1-one;actinium (PubChem CID 59085397) has the molecular formula C21H34AcO6 and a molecular weight of 609.50 g/mol. Its IUPAC name is (4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-5,6,10,10b-tetrahydroxy-3,4a,6a,7,7,10a-hexamethyl-2,5,6,8,9,10-hexahydrobenzo[f]chromen-1-one;actinium.
| Compound Name | (4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-5,6,10,10b-tetrahydroxy-3,4a,6a,7,7,10a-hexamethyl-2,5,6,8,9,10-hexahydrobenzo[f]chromen-1-one;actinium |
|---|---|
| PubChem CID | 59085397 |
| Molecular Formula | C21H34AcO6 |
| Molecular Weight | 609.50 g/mol |
| Exact Mass | 609.26 |
| IUPAC Name | (4aR,5S,6S,6aS,10S,10aR,10bS)-3-ethenyl-5,6,10,10b-tetrahydroxy-3,4a,6a,7,7,10a-hexamethyl-2,5,6,8,9,10-hexahydrobenzo[f]chromen-1-one;actinium |
| SMILES | C=CC1(C)CC(=O)[C@]2(O)[C@@]3(C)[C@@H](O)CCC(C)(C)[C@]3(C)[C@H](O)[C@H](O)[C@@]2(C)O1.[Ac] |
| InChI | InChI=1S/C21H34O6.Ac/c1-8-17(4)11-13(23)21(26)18(5)12(22)9-10-16(2,3)19(18,6)14(24)15(25)20(21,7)27-17;/h8,12,14-15,22,24-26H,1,9-11H2,2-7H3;/t12-,14+,15-,17?,18-,19-,20+,21-;/m0./s1 |
| InChIKey | RYKZRKICTYMNOB-WXKHLHKCSA-N |
| XLogP | 1.34 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.50 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|