C11H12O6 — CID 101261193
[(1S,2R,6S,7R)-3,5-dioxo-4,10-dioxatricyclo[5.2.1.02,6]decan-1-yl]methyl acetate (PubChem CID 101261193) has the molecular formula C11H12O6 and a molecular weight of 240.21 g/mol. Its IUPAC name is [(1S,2R,6S,7R)-3,5-dioxo-4,10-dioxatricyclo[5.2.1.02,6]decan-1-yl]methyl acetate.
| Compound Name | [(1S,2R,6S,7R)-3,5-dioxo-4,10-dioxatricyclo[5.2.1.02,6]decan-1-yl]methyl acetate |
|---|---|
| PubChem CID | 101261193 |
| Molecular Formula | C11H12O6 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | [(1S,2R,6S,7R)-3,5-dioxo-4,10-dioxatricyclo[5.2.1.02,6]decan-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]12CC[C@@H](O1)[C@H]1C(=O)OC(=O)[C@H]12 |
| InChI | InChI=1S/C11H12O6/c1-5(12)15-4-11-3-2-6(17-11)7-8(11)10(14)16-9(7)13/h6-8H,2-4H2,1H3/t6-,7-,8+,11-/m1/s1 |
| InChIKey | LAGVNFBAOLKZJU-HGIWHZBTSA-N |
| XLogP | -0.20 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|