C21H22O8 — CID 139257189
[(1S,7S,8R)-1-(2-methylpropanoyloxymethyl)-3,5-dioxo-4,10-dioxatricyclo[5.2.1.02,6]decan-8-yl]methyl benzoate (PubChem CID 139257189) has the molecular formula C21H22O8 and a molecular weight of 402.40 g/mol. Its IUPAC name is [(1S,7S,8R)-1-(2-methylpropanoyloxymethyl)-3,5-dioxo-4,10-dioxatricyclo[5.2.1.02,6]decan-8-yl]methyl benzoate.
| Compound Name | [(1S,7S,8R)-1-(2-methylpropanoyloxymethyl)-3,5-dioxo-4,10-dioxatricyclo[5.2.1.02,6]decan-8-yl]methyl benzoate |
|---|---|
| PubChem CID | 139257189 |
| Molecular Formula | C21H22O8 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | [(1S,7S,8R)-1-(2-methylpropanoyloxymethyl)-3,5-dioxo-4,10-dioxatricyclo[5.2.1.02,6]decan-8-yl]methyl benzoate |
| SMILES | CC(C)C(=O)OC[C@@]12C[C@H](COC(=O)c3ccccc3)[C@H](O1)C1C(=O)OC(=O)C12 |
| InChI | InChI=1S/C21H22O8/c1-11(2)17(22)27-10-21-8-13(9-26-18(23)12-6-4-3-5-7-12)16(29-21)14-15(21)20(25)28-19(14)24/h3-7,11,13-16H,8-10H2,1-2H3/t13-,14?,15?,16+,21-/m1/s1 |
| InChIKey | UXWHHESWKHKLRI-YFAWFDTDSA-N |
| XLogP | 1.52 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|