C25H22O8 — CID 139257133
[(1S,2R,6S,7R,8R)-8-(benzoyloxymethyl)-3,5-dioxo-4,10-dioxatricyclo[5.2.1.02,6]decan-1-yl]methyl 4-methylbenzoate (PubChem CID 139257133) has the molecular formula C25H22O8 and a molecular weight of 450.44 g/mol. Its IUPAC name is [(1S,2R,6S,7R,8R)-8-(benzoyloxymethyl)-3,5-dioxo-4,10-dioxatricyclo[5.2.1.02,6]decan-1-yl]methyl 4-methylbenzoate.
| Compound Name | [(1S,2R,6S,7R,8R)-8-(benzoyloxymethyl)-3,5-dioxo-4,10-dioxatricyclo[5.2.1.02,6]decan-1-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 139257133 |
| Molecular Formula | C25H22O8 |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | [(1S,2R,6S,7R,8R)-8-(benzoyloxymethyl)-3,5-dioxo-4,10-dioxatricyclo[5.2.1.02,6]decan-1-yl]methyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC[C@@]23C[C@H](COC(=O)c4ccccc4)[C@@H](O2)[C@H]2C(=O)OC(=O)[C@H]23)cc1 |
| InChI | InChI=1S/C25H22O8/c1-14-7-9-16(10-8-14)22(27)31-13-25-11-17(12-30-21(26)15-5-3-2-4-6-15)20(33-25)18-19(25)24(29)32-23(18)28/h2-10,17-20H,11-13H2,1H3/t17-,18+,19+,20-,25-/m1/s1 |
| InChIKey | DFMMUWPPFUYXMD-WERWAAGDSA-N |
| XLogP | 2.48 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|