C27H26O7S — CID 10719995
[(1R,2S)-2-(benzoyloxymethyl)-2-[(4-methylphenyl)sulfonyloxymethyl]cyclopropyl]methyl benzoate (PubChem CID 10719995) has the molecular formula C27H26O7S and a molecular weight of 494.57 g/mol. Its IUPAC name is [(1R,2S)-2-(benzoyloxymethyl)-2-[(4-methylphenyl)sulfonyloxymethyl]cyclopropyl]methyl benzoate.
| Compound Name | [(1R,2S)-2-(benzoyloxymethyl)-2-[(4-methylphenyl)sulfonyloxymethyl]cyclopropyl]methyl benzoate |
|---|---|
| PubChem CID | 10719995 |
| Molecular Formula | C27H26O7S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | [(1R,2S)-2-(benzoyloxymethyl)-2-[(4-methylphenyl)sulfonyloxymethyl]cyclopropyl]methyl benzoate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@]2(COC(=O)c3ccccc3)C[C@H]2COC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H26O7S/c1-20-12-14-24(15-13-20)35(30,31)34-19-27(18-33-26(29)22-10-6-3-7-11-22)16-23(27)17-32-25(28)21-8-4-2-5-9-21/h2-15,23H,16-19H2,1H3/t23-,27-/m0/s1 |
| InChIKey | KMZBHFPNYUIRBS-HOFKKMOUSA-N |
| XLogP | 4.42 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|