C27H26O7S — CID 88693263
[1-(benzoyloxymethyl)-2-methyl-2-(4-methylphenyl)sulfonyloxycyclopropyl]methyl benzoate (PubChem CID 88693263) has the molecular formula C27H26O7S and a molecular weight of 494.57 g/mol. Its IUPAC name is [1-(benzoyloxymethyl)-2-methyl-2-(4-methylphenyl)sulfonyloxycyclopropyl]methyl benzoate.
| Compound Name | [1-(benzoyloxymethyl)-2-methyl-2-(4-methylphenyl)sulfonyloxycyclopropyl]methyl benzoate |
|---|---|
| PubChem CID | 88693263 |
| Molecular Formula | C27H26O7S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | [1-(benzoyloxymethyl)-2-methyl-2-(4-methylphenyl)sulfonyloxycyclopropyl]methyl benzoate |
| SMILES | Cc1ccc(S(=O)(=O)OC2(C)CC2(COC(=O)c2ccccc2)COC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H26O7S/c1-20-13-15-23(16-14-20)35(30,31)34-26(2)17-27(26,18-32-24(28)21-9-5-3-6-10-21)19-33-25(29)22-11-7-4-8-12-22/h3-16H,17-19H2,1-2H3 |
| InChIKey | RZVYMTKNLPQPEJ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|