C27H26O9S — CID 141184462
[(2R,3S,4R,5S)-3-benzoyl-3,4-dihydroxy-5-[(4-methylphenyl)sulfonyloxymethyl]oxolan-2-yl]methyl benzoate (PubChem CID 141184462) has the molecular formula C27H26O9S and a molecular weight of 526.56 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-3-benzoyl-3,4-dihydroxy-5-[(4-methylphenyl)sulfonyloxymethyl]oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4R,5S)-3-benzoyl-3,4-dihydroxy-5-[(4-methylphenyl)sulfonyloxymethyl]oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 141184462 |
| Molecular Formula | C27H26O9S |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | [(2R,3S,4R,5S)-3-benzoyl-3,4-dihydroxy-5-[(4-methylphenyl)sulfonyloxymethyl]oxolan-2-yl]methyl benzoate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2O[C@H](COC(=O)c3ccccc3)[C@](O)(C(=O)c3ccccc3)[C@@H]2O)cc1 |
| InChI | InChI=1S/C27H26O9S/c1-18-12-14-21(15-13-18)37(32,33)35-16-22-25(29)27(31,24(28)19-8-4-2-5-9-19)23(36-22)17-34-26(30)20-10-6-3-7-11-20/h2-15,22-23,25,29,31H,16-17H2,1H3/t22-,23+,25+,27-/m0/s1 |
| InChIKey | RXULCVKEWDWPIO-UUNMANHLSA-N |
| XLogP | 2.30 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|