C23H24O8 — CID 139257186
[(1S,7S,8R)-1-(cyclopentanecarbonyloxymethyl)-3,5-dioxo-4,10-dioxatricyclo[5.2.1.02,6]decan-8-yl]methyl benzoate (PubChem CID 139257186) has the molecular formula C23H24O8 and a molecular weight of 428.44 g/mol. Its IUPAC name is [(1S,7S,8R)-1-(cyclopentanecarbonyloxymethyl)-3,5-dioxo-4,10-dioxatricyclo[5.2.1.02,6]decan-8-yl]methyl benzoate.
| Compound Name | [(1S,7S,8R)-1-(cyclopentanecarbonyloxymethyl)-3,5-dioxo-4,10-dioxatricyclo[5.2.1.02,6]decan-8-yl]methyl benzoate |
|---|---|
| PubChem CID | 139257186 |
| Molecular Formula | C23H24O8 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | [(1S,7S,8R)-1-(cyclopentanecarbonyloxymethyl)-3,5-dioxo-4,10-dioxatricyclo[5.2.1.02,6]decan-8-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1C[C@]2(COC(=O)C3CCCC3)O[C@@H]1C1C(=O)OC(=O)C12)c1ccccc1 |
| InChI | InChI=1S/C23H24O8/c24-19(13-6-2-1-3-7-13)28-11-15-10-23(12-29-20(25)14-8-4-5-9-14)17-16(18(15)31-23)21(26)30-22(17)27/h1-3,6-7,14-18H,4-5,8-12H2/t15-,16?,17?,18+,23-/m1/s1 |
| InChIKey | ZVCFZNPDPOJUSV-QYZMEMTRSA-N |
| XLogP | 2.05 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|