C17H19BrO5 — CID 134864315
[(3R,3aR,6R,7R,7aS)-7-bromo-6-hydroxy-6-methyl-5-oxo-2,3,3a,4,7,7a-hexahydro-1-benzofuran-3-yl]methyl benzoate (PubChem CID 134864315) has the molecular formula C17H19BrO5 and a molecular weight of 383.24 g/mol. Its IUPAC name is [(3R,3aR,6R,7R,7aS)-7-bromo-6-hydroxy-6-methyl-5-oxo-2,3,3a,4,7,7a-hexahydro-1-benzofuran-3-yl]methyl benzoate.
| Compound Name | [(3R,3aR,6R,7R,7aS)-7-bromo-6-hydroxy-6-methyl-5-oxo-2,3,3a,4,7,7a-hexahydro-1-benzofuran-3-yl]methyl benzoate |
|---|---|
| PubChem CID | 134864315 |
| Molecular Formula | C17H19BrO5 |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | [(3R,3aR,6R,7R,7aS)-7-bromo-6-hydroxy-6-methyl-5-oxo-2,3,3a,4,7,7a-hexahydro-1-benzofuran-3-yl]methyl benzoate |
| SMILES | C[C@@]1(O)C(=O)C[C@@H]2[C@@H](COC(=O)c3ccccc3)CO[C@@H]2[C@H]1Br |
| InChI | InChI=1S/C17H19BrO5/c1-17(21)13(19)7-12-11(8-22-14(12)15(17)18)9-23-16(20)10-5-3-2-4-6-10/h2-6,11-12,14-15,21H,7-9H2,1H3/t11-,12-,14+,15-,17-/m1/s1 |
| InChIKey | VAMHNSKZXALWOE-LGKWMFPGSA-N |
| XLogP | 1.96 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|