C13H14O5 — CID 98043712
ethyl (1S,2S,6R,7R)-3,5-dioxo-4-oxatricyclo[5.2.2.02,6]undec-8-ene-1-carboxylate (PubChem CID 98043712) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is ethyl (1S,2S,6R,7R)-3,5-dioxo-4-oxatricyclo[5.2.2.02,6]undec-8-ene-1-carboxylate.
| Compound Name | ethyl (1S,2S,6R,7R)-3,5-dioxo-4-oxatricyclo[5.2.2.02,6]undec-8-ene-1-carboxylate |
|---|---|
| PubChem CID | 98043712 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | ethyl (1S,2S,6R,7R)-3,5-dioxo-4-oxatricyclo[5.2.2.02,6]undec-8-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@]12C=C[C@@H](CC1)[C@H]1C(=O)OC(=O)[C@@H]12 |
| InChI | InChI=1S/C13H14O5/c1-2-17-12(16)13-5-3-7(4-6-13)8-9(13)11(15)18-10(8)14/h3,5,7-9H,2,4,6H2,1H3/t7-,8+,9+,13+/m0/s1 |
| InChIKey | YUHKVFTVEJNHJO-XHGVETGHSA-N |
| XLogP | 0.83 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|