C25H34O6 — CID 10717522
[(4S,5R,6S,7R,8R)-5-hydroxy-3,3,7,9-tetramethyl-6-[(Z)-2-methylbut-2-enoyl]oxy-11-oxo-4-tricyclo[5.4.0.02,8]undec-9-enyl] (Z)-2-methylbut-2-enoate (PubChem CID 10717522) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is [(4S,5R,6S,7R,8R)-5-hydroxy-3,3,7,9-tetramethyl-6-[(Z)-2-methylbut-2-enoyl]oxy-11-oxo-4-tricyclo[5.4.0.02,8]undec-9-enyl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(4S,5R,6S,7R,8R)-5-hydroxy-3,3,7,9-tetramethyl-6-[(Z)-2-methylbut-2-enoyl]oxy-11-oxo-4-tricyclo[5.4.0.02,8]undec-9-enyl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 10717522 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | [(4S,5R,6S,7R,8R)-5-hydroxy-3,3,7,9-tetramethyl-6-[(Z)-2-methylbut-2-enoyl]oxy-11-oxo-4-tricyclo[5.4.0.02,8]undec-9-enyl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)O[C@@H]1[C@@H](O)[C@@H](OC(=O)/C(C)=C\C)[C@@]2(C)C3C(=O)C=C(C)[C@H]2C3C1(C)C |
| InChI | InChI=1S/C25H34O6/c1-9-12(3)22(28)30-20-19(27)21(31-23(29)13(4)10-2)25(8)16-14(5)11-15(26)17(25)18(16)24(20,6)7/h9-11,16-21,27H,1-8H3/b12-9-,13-10-/t16-,17?,18?,19+,20+,21+,25+/m0/s1 |
| InChIKey | IHZSSMHUIMWFEW-NEMBIURDSA-N |
| XLogP | 3.54 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|