C16H20O4 — CID 134948200
methyl (1R,3aS,4S,7aS)-1-formyl-1,4,7a-trimethyl-3-methylidene-5-oxo-2,3a-dihydroindene-4-carboxylate (PubChem CID 134948200) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is methyl (1R,3aS,4S,7aS)-1-formyl-1,4,7a-trimethyl-3-methylidene-5-oxo-2,3a-dihydroindene-4-carboxylate.
| Compound Name | methyl (1R,3aS,4S,7aS)-1-formyl-1,4,7a-trimethyl-3-methylidene-5-oxo-2,3a-dihydroindene-4-carboxylate |
|---|---|
| PubChem CID | 134948200 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | methyl (1R,3aS,4S,7aS)-1-formyl-1,4,7a-trimethyl-3-methylidene-5-oxo-2,3a-dihydroindene-4-carboxylate |
| SMILES | C=C1C[C@@](C)(C=O)[C@@]2(C)C=CC(=O)[C@@](C)(C(=O)OC)[C@@H]12 |
| InChI | InChI=1S/C16H20O4/c1-10-8-14(2,9-17)15(3)7-6-11(18)16(4,12(10)15)13(19)20-5/h6-7,9,12H,1,8H2,2-5H3/t12-,14-,15-,16+/m0/s1 |
| InChIKey | SOPVJCRCZFIZLB-QCEMKRCNSA-N |
| XLogP | 2.09 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|