C26H34O7 — CID 170988890
methyl (1R,2S,4S,5S,10S,11S,13R,15S)-4,15-dihydroxy-2,6,6,10,13,15-hexamethyl-17-methylidene-7,14,16-trioxotetracyclo[11.3.1.02,11.05,10]heptadec-8-ene-1-carboxylate (PubChem CID 170988890) has the molecular formula C26H34O7 and a molecular weight of 458.55 g/mol. Its IUPAC name is methyl (1R,2S,4S,5S,10S,11S,13R,15S)-4,15-dihydroxy-2,6,6,10,13,15-hexamethyl-17-methylidene-7,14,16-trioxotetracyclo[11.3.1.02,11.05,10]heptadec-8-ene-1-carboxylate.
| Compound Name | methyl (1R,2S,4S,5S,10S,11S,13R,15S)-4,15-dihydroxy-2,6,6,10,13,15-hexamethyl-17-methylidene-7,14,16-trioxotetracyclo[11.3.1.02,11.05,10]heptadec-8-ene-1-carboxylate |
|---|---|
| PubChem CID | 170988890 |
| Molecular Formula | C26H34O7 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | methyl (1R,2S,4S,5S,10S,11S,13R,15S)-4,15-dihydroxy-2,6,6,10,13,15-hexamethyl-17-methylidene-7,14,16-trioxotetracyclo[11.3.1.02,11.05,10]heptadec-8-ene-1-carboxylate |
| SMILES | C=C1[C@@]2(C)C[C@H]3[C@]4(C)C=CC(=O)C(C)(C)[C@H]4[C@@H](O)C[C@]3(C)[C@]1(C(=O)OC)C(=O)[C@@](C)(O)C2=O |
| InChI | InChI=1S/C26H34O7/c1-13-23(5)12-15-22(4)10-9-16(28)21(2,3)17(22)14(27)11-24(15,6)26(13,20(31)33-8)19(30)25(7,32)18(23)29/h9-10,14-15,17,27,32H,1,11-12H2,2-8H3/t14-,15-,17+,22-,23+,24-,25-,26-/m0/s1 |
| InChIKey | JNICJSVLCZXARP-RIALSWAISA-N |
| XLogP | 2.19 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|