C30H46O5 — CID 163042348
17-(5,6-dihydroxy-7,7-dimethyloxepan-3-yl)-7-hydroxy-4,4,8,10,13-pentamethyl-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 163042348) has the molecular formula C30H46O5 and a molecular weight of 486.69 g/mol. Its IUPAC name is 17-(5,6-dihydroxy-7,7-dimethyloxepan-3-yl)-7-hydroxy-4,4,8,10,13-pentamethyl-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 17-(5,6-dihydroxy-7,7-dimethyloxepan-3-yl)-7-hydroxy-4,4,8,10,13-pentamethyl-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 163042348 |
| Molecular Formula | C30H46O5 |
| Molecular Weight | 486.69 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | 17-(5,6-dihydroxy-7,7-dimethyloxepan-3-yl)-7-hydroxy-4,4,8,10,13-pentamethyl-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC1(C)OCC(C2CC=C3C2(C)CCC2C4(C)C=CC(=O)C(C)(C)C4CC(O)C32C)CC(O)C1O |
| InChI | InChI=1S/C30H46O5/c1-26(2)22-15-24(33)30(7)20-9-8-18(17-14-19(31)25(34)27(3,4)35-16-17)28(20,5)12-10-21(30)29(22,6)13-11-23(26)32/h9,11,13,17-19,21-22,24-25,31,33-34H,8,10,12,14-16H2,1-7H3 |
| InChIKey | LMQJUMGIHTWTHY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.69 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|