C35H54O9 — CID 162911178
methyl 3-acetyloxy-3-[9-acetyloxy-3-(5,6-dihydroxy-7,7-dimethyloxepan-3-yl)-3a,6,9a-trimethyl-7-prop-1-en-2-yl-2,3,4,5,5a,7,8,9-octahydrocyclopenta[a]naphthalen-6-yl]propanoate (PubChem CID 162911178) has the molecular formula C35H54O9 and a molecular weight of 618.81 g/mol. Its IUPAC name is methyl 3-acetyloxy-3-[9-acetyloxy-3-(5,6-dihydroxy-7,7-dimethyloxepan-3-yl)-3a,6,9a-trimethyl-7-prop-1-en-2-yl-2,3,4,5,5a,7,8,9-octahydrocyclopenta[a]naphthalen-6-yl]propanoate.
| Compound Name | methyl 3-acetyloxy-3-[9-acetyloxy-3-(5,6-dihydroxy-7,7-dimethyloxepan-3-yl)-3a,6,9a-trimethyl-7-prop-1-en-2-yl-2,3,4,5,5a,7,8,9-octahydrocyclopenta[a]naphthalen-6-yl]propanoate |
|---|---|
| PubChem CID | 162911178 |
| Molecular Formula | C35H54O9 |
| Molecular Weight | 618.81 g/mol |
| Exact Mass | 618.38 |
| IUPAC Name | methyl 3-acetyloxy-3-[9-acetyloxy-3-(5,6-dihydroxy-7,7-dimethyloxepan-3-yl)-3a,6,9a-trimethyl-7-prop-1-en-2-yl-2,3,4,5,5a,7,8,9-octahydrocyclopenta[a]naphthalen-6-yl]propanoate |
| SMILES | C=C(C)C1CC(OC(C)=O)C2(C)C3=CCC(C4COC(C)(C)C(O)C(O)C4)C3(C)CCC2C1(C)C(CC(=O)OC)OC(C)=O |
| InChI | InChI=1S/C35H54O9/c1-19(2)24-16-28(43-20(3)36)35(9)26-12-11-23(22-15-25(38)31(40)32(5,6)42-18-22)33(26,7)14-13-27(35)34(24,8)29(44-21(4)37)17-30(39)41-10/h12,22-25,27-29,31,38,40H,1,11,13-18H2,2-10H3 |
| InChIKey | HOACHHFCSGSFJK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.81 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|