C33H46O8 — CID 163029828
[16-acetyloxy-11-hydroxy-1,5,10,15-tetramethyl-6-(5-oxooxolan-3-yl)-13-oxapentacyclo[10.6.1.02,10.05,9.015,19]nonadec-8-en-18-yl] 3-methylbut-2-enoate (PubChem CID 163029828) has the molecular formula C33H46O8 and a molecular weight of 570.72 g/mol. Its IUPAC name is [16-acetyloxy-11-hydroxy-1,5,10,15-tetramethyl-6-(5-oxooxolan-3-yl)-13-oxapentacyclo[10.6.1.02,10.05,9.015,19]nonadec-8-en-18-yl] 3-methylbut-2-enoate.
| Compound Name | [16-acetyloxy-11-hydroxy-1,5,10,15-tetramethyl-6-(5-oxooxolan-3-yl)-13-oxapentacyclo[10.6.1.02,10.05,9.015,19]nonadec-8-en-18-yl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 163029828 |
| Molecular Formula | C33H46O8 |
| Molecular Weight | 570.72 g/mol |
| Exact Mass | 570.32 |
| IUPAC Name | [16-acetyloxy-11-hydroxy-1,5,10,15-tetramethyl-6-(5-oxooxolan-3-yl)-13-oxapentacyclo[10.6.1.02,10.05,9.015,19]nonadec-8-en-18-yl] 3-methylbut-2-enoate |
| SMILES | CC(=O)OC1CC(OC(=O)C=C(C)C)C2(C)C3C(OCC13C)C(O)C1(C)C3=CCC(C4COC(=O)C4)C3(C)CCC12 |
| InChI | InChI=1S/C33H46O8/c1-17(2)12-26(36)41-24-14-23(40-18(3)34)31(5)16-39-27-28(31)33(24,7)22-10-11-30(4)20(19-13-25(35)38-15-19)8-9-21(30)32(22,6)29(27)37/h9,12,19-20,22-24,27-29,37H,8,10-11,13-16H2,1-7H3 |
| InChIKey | SIKLEZJEWHKJFN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.72 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|