C36H52O8 — CID 163075128
[1,3-diacetyloxy-4,4,8,10,13-pentamethyl-17-(5-oxo-6-propan-2-ylideneoxan-3-yl)-2,3,5,6,7,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-yl] acetate (PubChem CID 163075128) has the molecular formula C36H52O8 and a molecular weight of 612.80 g/mol. Its IUPAC name is [1,3-diacetyloxy-4,4,8,10,13-pentamethyl-17-(5-oxo-6-propan-2-ylideneoxan-3-yl)-2,3,5,6,7,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-yl] acetate.
| Compound Name | [1,3-diacetyloxy-4,4,8,10,13-pentamethyl-17-(5-oxo-6-propan-2-ylideneoxan-3-yl)-2,3,5,6,7,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-yl] acetate |
|---|---|
| PubChem CID | 163075128 |
| Molecular Formula | C36H52O8 |
| Molecular Weight | 612.80 g/mol |
| Exact Mass | 612.37 |
| IUPAC Name | [1,3-diacetyloxy-4,4,8,10,13-pentamethyl-17-(5-oxo-6-propan-2-ylideneoxan-3-yl)-2,3,5,6,7,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-yl] acetate |
| SMILES | CC(=O)OC1CC(OC(C)=O)C2(C)C(CC(OC(C)=O)C3(C)C4=CCC(C5COC(=C(C)C)C(=O)C5)C4(C)CCC32)C1(C)C |
| InChI | InChI=1S/C36H52O8/c1-19(2)32-25(40)15-23(18-41-32)24-11-12-26-34(24,8)14-13-27-35(26,9)30(43-21(4)38)16-28-33(6,7)29(42-20(3)37)17-31(36(27,28)10)44-22(5)39/h12,23-24,27-31H,11,13-18H2,1-10H3 |
| InChIKey | WLPYBUIVWFMEMI-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.80 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|