C29H46O4 — CID 162919395
(5R,9R,10R,13S,14S,17S)-17-[(3S,5R,6S)-5,6-dihydroxy-7,7-dimethyloxepan-3-yl]-4,4,10,13-tetramethyl-2,5,6,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 162919395) has the molecular formula C29H46O4 and a molecular weight of 458.68 g/mol. Its IUPAC name is (5R,9R,10R,13S,14S,17S)-17-[(3S,5R,6S)-5,6-dihydroxy-7,7-dimethyloxepan-3-yl]-4,4,10,13-tetramethyl-2,5,6,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (5R,9R,10R,13S,14S,17S)-17-[(3S,5R,6S)-5,6-dihydroxy-7,7-dimethyloxepan-3-yl]-4,4,10,13-tetramethyl-2,5,6,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 162919395 |
| Molecular Formula | C29H46O4 |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | (5R,9R,10R,13S,14S,17S)-17-[(3S,5R,6S)-5,6-dihydroxy-7,7-dimethyloxepan-3-yl]-4,4,10,13-tetramethyl-2,5,6,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC1(C)OC[C@H]([C@@H]2CC[C@@H]3C4=CC[C@H]5C(C)(C)C(=O)CC[C@]5(C)[C@H]4CC[C@]32C)C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C29H46O4/c1-26(2)23-10-7-18-20-9-8-19(17-15-22(30)25(32)27(3,4)33-16-17)28(20,5)13-11-21(18)29(23,6)14-12-24(26)31/h7,17,19-23,25,30,32H,8-16H2,1-6H3/t17-,19+,20-,21+,22-,23+,25+,28+,29-/m1/s1 |
| InChIKey | DIWBDVYNFMQRNC-CENHRWLLSA-N |
| XLogP | 5.31 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|