C20H32O5 — CID 162809707
7-(1,2-dihydroxyethyl)-5,8-dihydroxy-1,1,4a,7-tetramethyl-3,4,4b,5,6,8,10,10a-octahydrophenanthren-2-one (PubChem CID 162809707) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is 7-(1,2-dihydroxyethyl)-5,8-dihydroxy-1,1,4a,7-tetramethyl-3,4,4b,5,6,8,10,10a-octahydrophenanthren-2-one.
| Compound Name | 7-(1,2-dihydroxyethyl)-5,8-dihydroxy-1,1,4a,7-tetramethyl-3,4,4b,5,6,8,10,10a-octahydrophenanthren-2-one |
|---|---|
| PubChem CID | 162809707 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 7-(1,2-dihydroxyethyl)-5,8-dihydroxy-1,1,4a,7-tetramethyl-3,4,4b,5,6,8,10,10a-octahydrophenanthren-2-one |
| SMILES | CC1(C)C(=O)CCC2(C)C3C(=CCC12)C(O)C(C)(C(O)CO)CC3O |
| InChI | InChI=1S/C20H32O5/c1-18(2)13-6-5-11-16(19(13,3)8-7-14(18)23)12(22)9-20(4,17(11)25)15(24)10-21/h5,12-13,15-17,21-22,24-25H,6-10H2,1-4H3 |
| InChIKey | DJRNRZBGCNNCDD-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|