C27H40O5 — CID 23426323
[(5bR,11aR,13S,13aS)-1-hydroxy-5b,8,8,11a,13a-pentamethyl-9-oxo-3,5,5a,6,7,7a,10,11,11b,12,13,13b-dodecahydro-1H-phenanthro[2,1-e][2]benzofuran-13-yl] acetate (PubChem CID 23426323) has the molecular formula C27H40O5 and a molecular weight of 444.61 g/mol. Its IUPAC name is [(5bR,11aR,13S,13aS)-1-hydroxy-5b,8,8,11a,13a-pentamethyl-9-oxo-3,5,5a,6,7,7a,10,11,11b,12,13,13b-dodecahydro-1H-phenanthro[2,1-e][2]benzofuran-13-yl] acetate.
| Compound Name | [(5bR,11aR,13S,13aS)-1-hydroxy-5b,8,8,11a,13a-pentamethyl-9-oxo-3,5,5a,6,7,7a,10,11,11b,12,13,13b-dodecahydro-1H-phenanthro[2,1-e][2]benzofuran-13-yl] acetate |
|---|---|
| PubChem CID | 23426323 |
| Molecular Formula | C27H40O5 |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.29 |
| IUPAC Name | [(5bR,11aR,13S,13aS)-1-hydroxy-5b,8,8,11a,13a-pentamethyl-9-oxo-3,5,5a,6,7,7a,10,11,11b,12,13,13b-dodecahydro-1H-phenanthro[2,1-e][2]benzofuran-13-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC2[C@@]3(C)CCC(=O)C(C)(C)C3CC[C@@]2(C)C2CC=C3COC(O)C3[C@]21C |
| InChI | InChI=1S/C27H40O5/c1-15(28)32-21-13-19-25(4)12-10-20(29)24(2,3)17(25)9-11-26(19,5)18-8-7-16-14-31-23(30)22(16)27(18,21)6/h7,17-19,21-23,30H,8-14H2,1-6H3/t17?,18?,19?,21-,22?,23?,25-,26-,27+/m0/s1 |
| InChIKey | PJFYESSBDHDABR-WCMOUURQSA-N |
| XLogP | 4.67 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|