C28H36O7 — CID 177381307
[(1R,3bR,4R,5aR,10aR,10bR,12aS)-1-[(2S)-2-hydroxy-5-oxo-2H-furan-3-yl]-3b,6,6,10a,12a-pentamethyl-8-oxo-1,2,4,5,5a,10b,11,12-octahydroindeno[5,4-g][2]benzoxepin-4-yl] acetate (PubChem CID 177381307) has the molecular formula C28H36O7 and a molecular weight of 484.59 g/mol. Its IUPAC name is [(1R,3bR,4R,5aR,10aR,10bR,12aS)-1-[(2S)-2-hydroxy-5-oxo-2H-furan-3-yl]-3b,6,6,10a,12a-pentamethyl-8-oxo-1,2,4,5,5a,10b,11,12-octahydroindeno[5,4-g][2]benzoxepin-4-yl] acetate.
| Compound Name | [(1R,3bR,4R,5aR,10aR,10bR,12aS)-1-[(2S)-2-hydroxy-5-oxo-2H-furan-3-yl]-3b,6,6,10a,12a-pentamethyl-8-oxo-1,2,4,5,5a,10b,11,12-octahydroindeno[5,4-g][2]benzoxepin-4-yl] acetate |
|---|---|
| PubChem CID | 177381307 |
| Molecular Formula | C28H36O7 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | [(1R,3bR,4R,5aR,10aR,10bR,12aS)-1-[(2S)-2-hydroxy-5-oxo-2H-furan-3-yl]-3b,6,6,10a,12a-pentamethyl-8-oxo-1,2,4,5,5a,10b,11,12-octahydroindeno[5,4-g][2]benzoxepin-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H]2C(C)(C)OC(=O)C=C[C@]2(C)[C@H]2CC[C@]3(C)C(=CC[C@H]3C3=CC(=O)O[C@@H]3O)[C@@]21C |
| InChI | InChI=1S/C28H36O7/c1-15(29)33-21-14-20-25(2,3)35-22(30)10-12-27(20,5)19-9-11-26(4)17(7-8-18(26)28(19,21)6)16-13-23(31)34-24(16)32/h8,10,12-13,17,19-21,24,32H,7,9,11,14H2,1-6H3/t17-,19+,20-,21+,24-,26-,27+,28-/m0/s1 |
| InChIKey | QSDAMGXWSJDOBS-CSMVVSCPSA-N |
| XLogP | 4.01 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|