C38H52O12 — CID 85149906
methyl 1,7,11-triacetyloxy-17-(furan-3-yl)-3-hydroxy-4,8,10,13-tetramethyl-12-(2-methylbutanoyloxy)-2,3,5,6,7,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthrene-4-carboxylate (PubChem CID 85149906) has the molecular formula C38H52O12 and a molecular weight of 700.82 g/mol. Its IUPAC name is methyl 1,7,11-triacetyloxy-17-(furan-3-yl)-3-hydroxy-4,8,10,13-tetramethyl-12-(2-methylbutanoyloxy)-2,3,5,6,7,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthrene-4-carboxylate.
| Compound Name | methyl 1,7,11-triacetyloxy-17-(furan-3-yl)-3-hydroxy-4,8,10,13-tetramethyl-12-(2-methylbutanoyloxy)-2,3,5,6,7,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthrene-4-carboxylate |
|---|---|
| PubChem CID | 85149906 |
| Molecular Formula | C38H52O12 |
| Molecular Weight | 700.82 g/mol |
| Exact Mass | 700.35 |
| IUPAC Name | methyl 1,7,11-triacetyloxy-17-(furan-3-yl)-3-hydroxy-4,8,10,13-tetramethyl-12-(2-methylbutanoyloxy)-2,3,5,6,7,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthrene-4-carboxylate |
| SMILES | CCC(C)C(=O)OC1C(OC(C)=O)C2C(C)(C3=CCC(c4ccoc4)C31C)C(OC(C)=O)CC1C(C)(C(=O)OC)C(O)CC(OC(C)=O)C12C |
| InChI | InChI=1S/C38H52O12/c1-11-19(2)33(43)50-32-30(49-22(5)41)31-37(8,25-13-12-24(35(25,32)6)23-14-15-46-18-23)28(47-20(3)39)16-26-36(7,34(44)45-10)27(42)17-29(38(26,31)9)48-21(4)40/h13-15,18-19,24,26-32,42H,11-12,16-17H2,1-10H3 |
| InChIKey | ZHULVFZRDBVHPE-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 164.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.82 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|