C31H40O9 — CID 163156291
methyl 2-[(3R,4R,5S)-4-[(1S,5S,7S,7aS)-7-acetyloxy-1-(furan-3-yl)-7a-methyl-4-methylidene-2,5,6,7-tetrahydro-1H-inden-5-yl]-5-acetyloxy-2,2,4-trimethyl-7-oxooxepan-3-yl]acetate (PubChem CID 163156291) has the molecular formula C31H40O9 and a molecular weight of 556.65 g/mol. Its IUPAC name is methyl 2-[(3R,4R,5S)-4-[(1S,5S,7S,7aS)-7-acetyloxy-1-(furan-3-yl)-7a-methyl-4-methylidene-2,5,6,7-tetrahydro-1H-inden-5-yl]-5-acetyloxy-2,2,4-trimethyl-7-oxooxepan-3-yl]acetate.
| Compound Name | methyl 2-[(3R,4R,5S)-4-[(1S,5S,7S,7aS)-7-acetyloxy-1-(furan-3-yl)-7a-methyl-4-methylidene-2,5,6,7-tetrahydro-1H-inden-5-yl]-5-acetyloxy-2,2,4-trimethyl-7-oxooxepan-3-yl]acetate |
|---|---|
| PubChem CID | 163156291 |
| Molecular Formula | C31H40O9 |
| Molecular Weight | 556.65 g/mol |
| Exact Mass | 556.27 |
| IUPAC Name | methyl 2-[(3R,4R,5S)-4-[(1S,5S,7S,7aS)-7-acetyloxy-1-(furan-3-yl)-7a-methyl-4-methylidene-2,5,6,7-tetrahydro-1H-inden-5-yl]-5-acetyloxy-2,2,4-trimethyl-7-oxooxepan-3-yl]acetate |
| SMILES | C=C1C2=CC[C@@H](c3ccoc3)[C@]2(C)[C@@H](OC(C)=O)C[C@@H]1[C@@]1(C)[C@@H](OC(C)=O)CC(=O)OC(C)(C)[C@@H]1CC(=O)OC |
| InChI | InChI=1S/C31H40O9/c1-17-21-9-10-22(20-11-12-37-16-20)30(21,6)25(38-18(2)32)13-23(17)31(7)24(14-27(34)36-8)29(4,5)40-28(35)15-26(31)39-19(3)33/h9,11-12,16,22-26H,1,10,13-15H2,2-8H3/t22-,23-,24-,25-,26-,30+,31+/m0/s1 |
| InChIKey | PFSXEHMBIOIAMD-LUFVGXTESA-N |
| XLogP | 5.05 |
| TPSA | 118.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.65 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|