C31H38O10 — CID 162873060
methyl 2-acetyloxy-2-[14-acetyloxy-6-(furan-3-yl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-2(11)-en-16-yl]acetate (PubChem CID 162873060) has the molecular formula C31H38O10 and a molecular weight of 570.64 g/mol. Its IUPAC name is methyl 2-acetyloxy-2-[14-acetyloxy-6-(furan-3-yl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-2(11)-en-16-yl]acetate.
| Compound Name | methyl 2-acetyloxy-2-[14-acetyloxy-6-(furan-3-yl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-2(11)-en-16-yl]acetate |
|---|---|
| PubChem CID | 162873060 |
| Molecular Formula | C31H38O10 |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | methyl 2-acetyloxy-2-[14-acetyloxy-6-(furan-3-yl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-2(11)-en-16-yl]acetate |
| SMILES | COC(=O)C(OC(C)=O)C1C2(C)C(=O)C(CC3=C2CCC2(C)C3CC(=O)OC2c2ccoc2)C(OC(C)=O)C1(C)C |
| InChI | InChI=1S/C31H38O10/c1-15(32)39-23(28(36)37-7)24-29(3,4)27(40-16(2)33)19-12-18-20(31(24,6)25(19)35)8-10-30(5)21(18)13-22(34)41-26(30)17-9-11-38-14-17/h9,11,14,19,21,23-24,26-27H,8,10,12-13H2,1-7H3 |
| InChIKey | RKXZPEXGKVKIBT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 135.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|