C31H38O10 — CID 162961743
[(1S,2R,5R,6R,13S,14R,16S)-16-(diacetyloxymethyl)-6-(furan-3-yl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-10-en-14-yl] acetate (PubChem CID 162961743) has the molecular formula C31H38O10 and a molecular weight of 570.64 g/mol. Its IUPAC name is [(1S,2R,5R,6R,13S,14R,16S)-16-(diacetyloxymethyl)-6-(furan-3-yl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-10-en-14-yl] acetate.
| Compound Name | [(1S,2R,5R,6R,13S,14R,16S)-16-(diacetyloxymethyl)-6-(furan-3-yl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-10-en-14-yl] acetate |
|---|---|
| PubChem CID | 162961743 |
| Molecular Formula | C31H38O10 |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | [(1S,2R,5R,6R,13S,14R,16S)-16-(diacetyloxymethyl)-6-(furan-3-yl)-1,5,15,15-tetramethyl-8,17-dioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-10-en-14-yl] acetate |
| SMILES | CC(=O)OC(OC(C)=O)[C@H]1C(C)(C)[C@H](OC(C)=O)[C@@H]2CC3=C4CC(=O)O[C@@H](c5ccoc5)[C@]4(C)CC[C@H]3[C@]1(C)C2=O |
| InChI | InChI=1S/C31H38O10/c1-15(32)38-27-20-12-19-21(8-10-30(6)22(19)13-23(35)41-26(30)18-9-11-37-14-18)31(7,25(20)36)24(29(27,4)5)28(39-16(2)33)40-17(3)34/h9,11,14,20-21,24,26-28H,8,10,12-13H2,1-7H3/t20-,21-,24+,26+,27-,30-,31+/m1/s1 |
| InChIKey | RMOKIKYJZPSPLW-RLBPKYTJSA-N |
| XLogP | 4.62 |
| TPSA | 135.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|