C31H41BO9 — CID 178037339
CID 178037339 (PubChem CID 178037339) has the molecular formula C31H41BO9 and a molecular weight of 568.47 g/mol.
| Compound Name | CID 178037339 |
|---|---|
| PubChem CID | 178037339 |
| Molecular Formula | C31H41BO9 |
| Molecular Weight | 568.47 g/mol |
| Exact Mass | 568.28 |
| IUPAC Name | — |
| SMILES | [B]C12C(O)C3(C)CC14OC(C)(C)OC1(CCC5(C)C(c6ccoc6)OC(=O)CC5C1(C)C2O)C4(C)C3CC(=O)OC |
| InChI | InChI=1S/C31H41BO9/c1-24(2)40-29-10-9-25(3)17(12-20(34)39-21(25)16-8-11-38-14-16)27(29,5)23(36)31(32)22(35)26(4)15-30(31,41-24)28(29,6)18(26)13-19(33)37-7/h8,11,14,17-18,21-23,35-36H,9-10,12-13,15H2,1-7H3 |
| InChIKey | WZVWQEWRTRHFQC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 124.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|