C27H32O9 — CID 162884206
methyl 2-[8-(furan-3-yl)-1,3-dihydroxy-7,16,18-trimethyl-10,15-dioxo-9,13-dioxahexacyclo[14.2.1.02,14.03,12.04,18.07,12]nonadecan-17-yl]acetate (PubChem CID 162884206) has the molecular formula C27H32O9 and a molecular weight of 500.54 g/mol. Its IUPAC name is methyl 2-[8-(furan-3-yl)-1,3-dihydroxy-7,16,18-trimethyl-10,15-dioxo-9,13-dioxahexacyclo[14.2.1.02,14.03,12.04,18.07,12]nonadecan-17-yl]acetate.
| Compound Name | methyl 2-[8-(furan-3-yl)-1,3-dihydroxy-7,16,18-trimethyl-10,15-dioxo-9,13-dioxahexacyclo[14.2.1.02,14.03,12.04,18.07,12]nonadecan-17-yl]acetate |
|---|---|
| PubChem CID | 162884206 |
| Molecular Formula | C27H32O9 |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | methyl 2-[8-(furan-3-yl)-1,3-dihydroxy-7,16,18-trimethyl-10,15-dioxo-9,13-dioxahexacyclo[14.2.1.02,14.03,12.04,18.07,12]nonadecan-17-yl]acetate |
| SMILES | COC(=O)CC1C2(C)CC3(O)C4C(OC56CC(=O)OC(c7ccoc7)C5(C)CCC(C13C)C46O)C2=O |
| InChI | InChI=1S/C27H32O9/c1-22-12-25(31)19-18(20(22)30)36-26-10-17(29)35-21(13-6-8-34-11-13)23(26,2)7-5-14(27(19,26)32)24(25,3)15(22)9-16(28)33-4/h6,8,11,14-15,18-19,21,31-32H,5,7,9-10,12H2,1-4H3 |
| InChIKey | PXRXLWABTZZHDT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |