C27H34O8 — CID 163011016
methyl 2-[7-(furan-3-yl)-3-hydroxy-8,12,14,14-tetramethyl-5,18-dioxo-6,16-dioxapentacyclo[10.4.2.02,11.03,8.015,17]octadecan-13-yl]acetate (PubChem CID 163011016) has the molecular formula C27H34O8 and a molecular weight of 486.56 g/mol. Its IUPAC name is methyl 2-[7-(furan-3-yl)-3-hydroxy-8,12,14,14-tetramethyl-5,18-dioxo-6,16-dioxapentacyclo[10.4.2.02,11.03,8.015,17]octadecan-13-yl]acetate.
| Compound Name | methyl 2-[7-(furan-3-yl)-3-hydroxy-8,12,14,14-tetramethyl-5,18-dioxo-6,16-dioxapentacyclo[10.4.2.02,11.03,8.015,17]octadecan-13-yl]acetate |
|---|---|
| PubChem CID | 163011016 |
| Molecular Formula | C27H34O8 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | methyl 2-[7-(furan-3-yl)-3-hydroxy-8,12,14,14-tetramethyl-5,18-dioxo-6,16-dioxapentacyclo[10.4.2.02,11.03,8.015,17]octadecan-13-yl]acetate |
| SMILES | COC(=O)CC1C(C)(C)C2OC3C2C(=O)C1(C)C1CCC2(C)C(c4ccoc4)OC(=O)CC2(O)C31 |
| InChI | InChI=1S/C27H34O8/c1-24(2)15(10-16(28)32-5)26(4)14-6-8-25(3)22(13-7-9-33-12-13)34-17(29)11-27(25,31)19(14)20-18(21(26)30)23(24)35-20/h7,9,12,14-15,18-20,22-23,31H,6,8,10-11H2,1-5H3 |
| InChIKey | GZYBZGFGYJNASN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |