C20H28O7 — CID 163034015
(3R,4R,4aS,5'R,7S,8R,8aR)-5'-(furan-3-yl)-3,4,7,8a-tetrahydroxy-4,4a,7-trimethylspiro[2,3,5,6-tetrahydro-1H-naphthalene-8,3'-oxolane]-2'-one (PubChem CID 163034015) has the molecular formula C20H28O7 and a molecular weight of 380.44 g/mol. Its IUPAC name is (3R,4R,4aS,5'R,7S,8R,8aR)-5'-(furan-3-yl)-3,4,7,8a-tetrahydroxy-4,4a,7-trimethylspiro[2,3,5,6-tetrahydro-1H-naphthalene-8,3'-oxolane]-2'-one.
| Compound Name | (3R,4R,4aS,5'R,7S,8R,8aR)-5'-(furan-3-yl)-3,4,7,8a-tetrahydroxy-4,4a,7-trimethylspiro[2,3,5,6-tetrahydro-1H-naphthalene-8,3'-oxolane]-2'-one |
|---|---|
| PubChem CID | 163034015 |
| Molecular Formula | C20H28O7 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (3R,4R,4aS,5'R,7S,8R,8aR)-5'-(furan-3-yl)-3,4,7,8a-tetrahydroxy-4,4a,7-trimethylspiro[2,3,5,6-tetrahydro-1H-naphthalene-8,3'-oxolane]-2'-one |
| SMILES | C[C@]12CC[C@](C)(O)[C@]3(C[C@H](c4ccoc4)OC3=O)[C@@]1(O)CC[C@@H](O)[C@]2(C)O |
| InChI | InChI=1S/C20H28O7/c1-16-7-8-17(2,23)19(20(16,25)6-4-14(21)18(16,3)24)10-13(27-15(19)22)12-5-9-26-11-12/h5,9,11,13-14,21,23-25H,4,6-8,10H2,1-3H3/t13-,14-,16-,17+,18+,19-,20-/m1/s1 |
| InChIKey | WLUNQOQCSYHZAU-QAJMTZOZSA-N |
| XLogP | 1.44 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |