C20H22O7 — CID 14829114
5'-(furan-3-yl)-8-hydroxy-8-methylspiro[3a,4,5,6,6a,9-hexahydro-1H-benzo[d][2]benzofuran-7,3'-oxolane]-2',3,10-trione (PubChem CID 14829114) has the molecular formula C20H22O7 and a molecular weight of 374.39 g/mol. Its IUPAC name is 5'-(furan-3-yl)-8-hydroxy-8-methylspiro[3a,4,5,6,6a,9-hexahydro-1H-benzo[d][2]benzofuran-7,3'-oxolane]-2',3,10-trione.
| Compound Name | 5'-(furan-3-yl)-8-hydroxy-8-methylspiro[3a,4,5,6,6a,9-hexahydro-1H-benzo[d][2]benzofuran-7,3'-oxolane]-2',3,10-trione |
|---|---|
| PubChem CID | 14829114 |
| Molecular Formula | C20H22O7 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 5'-(furan-3-yl)-8-hydroxy-8-methylspiro[3a,4,5,6,6a,9-hexahydro-1H-benzo[d][2]benzofuran-7,3'-oxolane]-2',3,10-trione |
| SMILES | CC1(O)CC(=O)C23COC(=O)C2CCCC3C12CC(c1ccoc1)OC2=O |
| InChI | InChI=1S/C20H22O7/c1-18(24)8-15(21)19-10-26-16(22)12(19)3-2-4-14(19)20(18)7-13(27-17(20)23)11-5-6-25-9-11/h5-6,9,12-14,24H,2-4,7-8,10H2,1H3 |
| InChIKey | FDEIYBATZJRUJK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |