C22H22O8 — CID 59052872
[(1R,2R,4S,11R,13R,15R)-15-(furan-3-yl)-13-methyl-7,17-dioxo-6,16,18-trioxapentacyclo[9.6.1.01,13.04,8.04,12]octadec-8-en-2-yl] acetate (PubChem CID 59052872) has the molecular formula C22H22O8 and a molecular weight of 414.41 g/mol. Its IUPAC name is [(1R,2R,4S,11R,13R,15R)-15-(furan-3-yl)-13-methyl-7,17-dioxo-6,16,18-trioxapentacyclo[9.6.1.01,13.04,8.04,12]octadec-8-en-2-yl] acetate.
| Compound Name | [(1R,2R,4S,11R,13R,15R)-15-(furan-3-yl)-13-methyl-7,17-dioxo-6,16,18-trioxapentacyclo[9.6.1.01,13.04,8.04,12]octadec-8-en-2-yl] acetate |
|---|---|
| PubChem CID | 59052872 |
| Molecular Formula | C22H22O8 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | [(1R,2R,4S,11R,13R,15R)-15-(furan-3-yl)-13-methyl-7,17-dioxo-6,16,18-trioxapentacyclo[9.6.1.01,13.04,8.04,12]octadec-8-en-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@]23COC(=O)C2=CCC2O[C@@]14C(=O)O[C@@H](c1ccoc1)C[C@]4(C)C23 |
| InChI | InChI=1S/C22H22O8/c1-11(23)28-16-8-21-10-27-18(24)13(21)3-4-14-17(21)20(2)7-15(12-5-6-26-9-12)29-19(25)22(16,20)30-14/h3,5-6,9,14-17H,4,7-8,10H2,1-2H3/t14?,15-,16-,17?,20-,21-,22-/m1/s1 |
| InChIKey | SLBOOGLVNFJFOD-BEWQYOHASA-N |
| XLogP | 2.24 |
| TPSA | 101.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|