C24H30O8 — CID 162822505
[(1S,3S,5S,6S,7R,8R,9S,10R,13S)-8-acetyloxy-3-(furan-3-yl)-5,6,9-trimethyl-11-oxospiro[2-oxatricyclo[7.3.1.05,13]tridecane-10,2'-oxirane]-7-yl] acetate (PubChem CID 162822505) has the molecular formula C24H30O8 and a molecular weight of 446.50 g/mol. Its IUPAC name is [(1S,3S,5S,6S,7R,8R,9S,10R,13S)-8-acetyloxy-3-(furan-3-yl)-5,6,9-trimethyl-11-oxospiro[2-oxatricyclo[7.3.1.05,13]tridecane-10,2'-oxirane]-7-yl] acetate.
| Compound Name | [(1S,3S,5S,6S,7R,8R,9S,10R,13S)-8-acetyloxy-3-(furan-3-yl)-5,6,9-trimethyl-11-oxospiro[2-oxatricyclo[7.3.1.05,13]tridecane-10,2'-oxirane]-7-yl] acetate |
|---|---|
| PubChem CID | 162822505 |
| Molecular Formula | C24H30O8 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | [(1S,3S,5S,6S,7R,8R,9S,10R,13S)-8-acetyloxy-3-(furan-3-yl)-5,6,9-trimethyl-11-oxospiro[2-oxatricyclo[7.3.1.05,13]tridecane-10,2'-oxirane]-7-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](C)[C@]2(C)C[C@@H](c3ccoc3)O[C@H]3CC(=O)[C@]4(CO4)[C@](C)([C@H]1OC(C)=O)[C@@H]32 |
| InChI | InChI=1S/C24H30O8/c1-12-19(30-13(2)25)21(31-14(3)26)23(5)20-16(8-18(27)24(23)11-29-24)32-17(9-22(12,20)4)15-6-7-28-10-15/h6-7,10,12,16-17,19-21H,8-9,11H2,1-5H3/t12-,16+,17+,19-,20+,21+,22+,23+,24-/m1/s1 |
| InChIKey | PQQMXLRTXXSPHK-TZHGYNAJSA-N |
| XLogP | 2.99 |
| TPSA | 104.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|