C24H30O9 — CID 163043055
CID 163043055 (PubChem CID 163043055) has the molecular formula C24H30O9 and a molecular weight of 462.50 g/mol.
| Compound Name | CID 163043055 |
|---|---|
| PubChem CID | 163043055 |
| Molecular Formula | C24H30O9 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | — |
| SMILES | CC(=O)OC[C@@]12C(=O)C[C@@H](C)[C@]3(C[C@@H](c4ccoc4)O[C@H]3OC(C)=O)[C@H]1CC[C@H](O)[C@]21CO1 |
| InChI | InChI=1S/C24H30O9/c1-13-8-20(28)23(11-30-14(2)25)18(4-5-19(27)24(23)12-31-24)22(13)9-17(16-6-7-29-10-16)33-21(22)32-15(3)26/h6-7,10,13,17-19,21,27H,4-5,8-9,11-12H2,1-3H3/t13-,17+,18-,19+,21-,22-,23+,24-/m1/s1 |
| InChIKey | ZNOWAPXQORXMEX-GQPDYXGWSA-N |
| XLogP | 2.31 |
| TPSA | 124.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|