C23H30O8 — CID 163093052
CID 163093052 (PubChem CID 163093052) has the molecular formula C23H30O8 and a molecular weight of 434.49 g/mol.
| Compound Name | CID 163093052 |
|---|---|
| PubChem CID | 163093052 |
| Molecular Formula | C23H30O8 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | — |
| SMILES | CO[C@@H]1O[C@H](c2ccoc2)C[C@]12[C@H]1CCC[C@@]3(CO3)[C@@]1(COC(C)=O)[C@@H](O)C(=O)[C@@H]2C |
| InChI | InChI=1S/C23H30O8/c1-13-18(25)19(26)23(12-29-14(2)24)17(5-4-7-21(23)11-30-21)22(13)9-16(31-20(22)27-3)15-6-8-28-10-15/h6,8,10,13,16-17,19-20,26H,4-5,7,9,11-12H2,1-3H3/t13-,16-,17+,19-,20+,21+,22-,23+/m0/s1 |
| InChIKey | KWYPDYJVSNSDPA-PRFUFBJVSA-N |
| XLogP | 2.40 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|