C22H28O8 — CID 162915275
[(1S)-2-[(1R,2R,6S,7S,8R,11R,13S)-8,11-dihydroxy-13-methyl-12-oxospiro[9-oxatricyclo[5.3.3.01,6]tridecane-2,2'-oxirane]-7-yl]-1-(furan-3-yl)ethyl] acetate (PubChem CID 162915275) has the molecular formula C22H28O8 and a molecular weight of 420.46 g/mol. Its IUPAC name is [(1S)-2-[(1R,2R,6S,7S,8R,11R,13S)-8,11-dihydroxy-13-methyl-12-oxospiro[9-oxatricyclo[5.3.3.01,6]tridecane-2,2'-oxirane]-7-yl]-1-(furan-3-yl)ethyl] acetate.
| Compound Name | [(1S)-2-[(1R,2R,6S,7S,8R,11R,13S)-8,11-dihydroxy-13-methyl-12-oxospiro[9-oxatricyclo[5.3.3.01,6]tridecane-2,2'-oxirane]-7-yl]-1-(furan-3-yl)ethyl] acetate |
|---|---|
| PubChem CID | 162915275 |
| Molecular Formula | C22H28O8 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | [(1S)-2-[(1R,2R,6S,7S,8R,11R,13S)-8,11-dihydroxy-13-methyl-12-oxospiro[9-oxatricyclo[5.3.3.01,6]tridecane-2,2'-oxirane]-7-yl]-1-(furan-3-yl)ethyl] acetate |
| SMILES | CC(=O)O[C@@H](C[C@]12[C@H](O)OC[C@]3([C@@H]1CCC[C@]31CO1)[C@@H](O)C(=O)[C@H]2C)c1ccoc1 |
| InChI | InChI=1S/C22H28O8/c1-12-17(24)18(25)22-11-28-19(26)21(12,16(22)4-3-6-20(22)10-29-20)8-15(30-13(2)23)14-5-7-27-9-14/h5,7,9,12,15-16,18-19,25-26H,3-4,6,8,10-11H2,1-2H3/t12-,15+,16-,18+,19-,20+,21-,22+/m1/s1 |
| InChIKey | ZOVARCOHEIZNCO-BZQJATGJSA-N |
| XLogP | 1.74 |
| TPSA | 118.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|