C30H42O11 — CID 23265183
[8-acetyloxy-5-[2-acetyloxy-2-(furan-3-yl)ethyl]-5,8a-bis(acetyloxymethyl)-6-methyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]methyl acetate (PubChem CID 23265183) has the molecular formula C30H42O11 and a molecular weight of 578.66 g/mol. Its IUPAC name is [8-acetyloxy-5-[2-acetyloxy-2-(furan-3-yl)ethyl]-5,8a-bis(acetyloxymethyl)-6-methyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]methyl acetate.
| Compound Name | [8-acetyloxy-5-[2-acetyloxy-2-(furan-3-yl)ethyl]-5,8a-bis(acetyloxymethyl)-6-methyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 23265183 |
| Molecular Formula | C30H42O11 |
| Molecular Weight | 578.66 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | [8-acetyloxy-5-[2-acetyloxy-2-(furan-3-yl)ethyl]-5,8a-bis(acetyloxymethyl)-6-methyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]methyl acetate |
| SMILES | CC(=O)OCC1CCCC2C(COC(C)=O)(CC(OC(C)=O)c3ccoc3)C(C)CC(OC(C)=O)C12COC(C)=O |
| InChI | InChI=1S/C30H42O11/c1-18-12-28(41-23(6)35)30(17-39-21(4)33)25(15-37-19(2)31)8-7-9-27(30)29(18,16-38-20(3)32)13-26(40-22(5)34)24-10-11-36-14-24/h10-11,14,18,25-28H,7-9,12-13,15-17H2,1-6H3 |
| InChIKey | HSQJZNKWISBYBF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 144.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.66 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|