C24H30O7 — CID 23786274
[(6aR,7R,8S,9R,10aS)-7-[2-acetyloxy-2-(furan-3-yl)ethyl]-7,8-dimethyl-3-oxo-5,6,6a,8,9,10-hexahydro-1H-benzo[d][2]benzofuran-9-yl] acetate (PubChem CID 23786274) has the molecular formula C24H30O7 and a molecular weight of 430.50 g/mol. Its IUPAC name is [(6aR,7R,8S,9R,10aS)-7-[2-acetyloxy-2-(furan-3-yl)ethyl]-7,8-dimethyl-3-oxo-5,6,6a,8,9,10-hexahydro-1H-benzo[d][2]benzofuran-9-yl] acetate.
| Compound Name | [(6aR,7R,8S,9R,10aS)-7-[2-acetyloxy-2-(furan-3-yl)ethyl]-7,8-dimethyl-3-oxo-5,6,6a,8,9,10-hexahydro-1H-benzo[d][2]benzofuran-9-yl] acetate |
|---|---|
| PubChem CID | 23786274 |
| Molecular Formula | C24H30O7 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | [(6aR,7R,8S,9R,10aS)-7-[2-acetyloxy-2-(furan-3-yl)ethyl]-7,8-dimethyl-3-oxo-5,6,6a,8,9,10-hexahydro-1H-benzo[d][2]benzofuran-9-yl] acetate |
| SMILES | CC(=O)OC(C[C@@]1(C)[C@H](C)[C@H](OC(C)=O)C[C@@]23COC(=O)C2=CCC[C@@H]31)c1ccoc1 |
| InChI | InChI=1S/C24H30O7/c1-14-19(30-15(2)25)11-24-13-29-22(27)18(24)6-5-7-21(24)23(14,4)10-20(31-16(3)26)17-8-9-28-12-17/h6,8-9,12,14,19-21H,5,7,10-11,13H2,1-4H3/t14-,19-,20?,21-,23+,24-/m1/s1 |
| InChIKey | RISODYLYNMYPPG-HWEUVANKSA-N |
| XLogP | 4.13 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|