C20H30O5 — CID 85274643
6-[2-(furan-3-yl)-2-hydroxyethyl]-2a-(hydroxymethyl)-6,7-dimethyl-1,3,4,5,5a,7,8,9-octahydronaphtho[8,8a-b]oxet-9-ol (PubChem CID 85274643) has the molecular formula C20H30O5 and a molecular weight of 350.45 g/mol. Its IUPAC name is 6-[2-(furan-3-yl)-2-hydroxyethyl]-2a-(hydroxymethyl)-6,7-dimethyl-1,3,4,5,5a,7,8,9-octahydronaphtho[8,8a-b]oxet-9-ol.
| Compound Name | 6-[2-(furan-3-yl)-2-hydroxyethyl]-2a-(hydroxymethyl)-6,7-dimethyl-1,3,4,5,5a,7,8,9-octahydronaphtho[8,8a-b]oxet-9-ol |
|---|---|
| PubChem CID | 85274643 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 6-[2-(furan-3-yl)-2-hydroxyethyl]-2a-(hydroxymethyl)-6,7-dimethyl-1,3,4,5,5a,7,8,9-octahydronaphtho[8,8a-b]oxet-9-ol |
| SMILES | CC1CC(O)C23COC2(CO)CCCC3C1(C)CC(O)c1ccoc1 |
| InChI | InChI=1S/C20H30O5/c1-13-8-17(23)20-12-25-19(20,11-21)6-3-4-16(20)18(13,2)9-15(22)14-5-7-24-10-14/h5,7,10,13,15-17,21-23H,3-4,6,8-9,11-12H2,1-2H3 |
| InChIKey | QTKUKPZFMJWCPE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |