C22H30O8 — CID 24823484
dimethyl (1R,3S,4aS,5R,6R,8aR)-5-[2-(furan-3-yl)-2-hydroxyethyl]-3-hydroxy-5,8a-dimethyl-4-oxo-2,3,4a,6,7,8-hexahydro-1H-naphthalene-1,6-dicarboxylate (PubChem CID 24823484) has the molecular formula C22H30O8 and a molecular weight of 422.47 g/mol. Its IUPAC name is dimethyl (1R,3S,4aS,5R,6R,8aR)-5-[2-(furan-3-yl)-2-hydroxyethyl]-3-hydroxy-5,8a-dimethyl-4-oxo-2,3,4a,6,7,8-hexahydro-1H-naphthalene-1,6-dicarboxylate.
| Compound Name | dimethyl (1R,3S,4aS,5R,6R,8aR)-5-[2-(furan-3-yl)-2-hydroxyethyl]-3-hydroxy-5,8a-dimethyl-4-oxo-2,3,4a,6,7,8-hexahydro-1H-naphthalene-1,6-dicarboxylate |
|---|---|
| PubChem CID | 24823484 |
| Molecular Formula | C22H30O8 |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | dimethyl (1R,3S,4aS,5R,6R,8aR)-5-[2-(furan-3-yl)-2-hydroxyethyl]-3-hydroxy-5,8a-dimethyl-4-oxo-2,3,4a,6,7,8-hexahydro-1H-naphthalene-1,6-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](O)C(=O)[C@H]2[C@@]1(C)CC[C@@H](C(=O)OC)[C@]2(C)CC(O)c1ccoc1 |
| InChI | InChI=1S/C22H30O8/c1-21-7-5-13(19(26)28-3)22(2,10-16(24)12-6-8-30-11-12)18(21)17(25)15(23)9-14(21)20(27)29-4/h6,8,11,13-16,18,23-24H,5,7,9-10H2,1-4H3/t13-,14-,15-,16?,18-,21-,22-/m0/s1 |
| InChIKey | XXHAZMIQKCDINX-INIASSJFSA-N |
| XLogP | 2.04 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |