C25H32O9 — CID 100919411
CID 100919411 (PubChem CID 100919411) has the molecular formula C25H32O9 and a molecular weight of 476.52 g/mol.
| Compound Name | CID 100919411 |
|---|---|
| PubChem CID | 100919411 |
| Molecular Formula | C25H32O9 |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | — |
| SMILES | CO[C@@H]1O[C@H](c2ccoc2)C[C@]12[C@H](C)[C@@H](OC(C)=O)C(=O)[C@@]1(COC(C)=O)[C@H]2CCC[C@]12CO2 |
| InChI | InChI=1S/C25H32O9/c1-14-20(33-16(3)27)21(28)25(13-31-15(2)26)19(6-5-8-23(25)12-32-23)24(14)10-18(34-22(24)29-4)17-7-9-30-11-17/h7,9,11,14,18-20,22H,5-6,8,10,12-13H2,1-4H3/t14-,18+,19+,20-,22-,23+,24-,25-/m1/s1 |
| InChIKey | FBDPJGJNVLZMIM-MKAWTCKPSA-N |
| XLogP | 2.97 |
| TPSA | 113.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|