C21H24O6 — CID 162906275
methyl (3S,4aR,7aR,8S,11aR)-3-(furan-3-yl)-5,8-dimethyl-1,7-dioxo-4,4a,7a,9,10,11-hexahydro-3H-benzo[i]isochromene-8-carboxylate (PubChem CID 162906275) has the molecular formula C21H24O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is methyl (3S,4aR,7aR,8S,11aR)-3-(furan-3-yl)-5,8-dimethyl-1,7-dioxo-4,4a,7a,9,10,11-hexahydro-3H-benzo[i]isochromene-8-carboxylate.
| Compound Name | methyl (3S,4aR,7aR,8S,11aR)-3-(furan-3-yl)-5,8-dimethyl-1,7-dioxo-4,4a,7a,9,10,11-hexahydro-3H-benzo[i]isochromene-8-carboxylate |
|---|---|
| PubChem CID | 162906275 |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | methyl (3S,4aR,7aR,8S,11aR)-3-(furan-3-yl)-5,8-dimethyl-1,7-dioxo-4,4a,7a,9,10,11-hexahydro-3H-benzo[i]isochromene-8-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CCC[C@@]23C(=O)O[C@H](c4ccoc4)C[C@@H]2C(C)=CC(=O)[C@@H]31 |
| InChI | InChI=1S/C21H24O6/c1-12-9-15(22)17-20(2,18(23)25-3)6-4-7-21(17)14(12)10-16(27-19(21)24)13-5-8-26-11-13/h5,8-9,11,14,16-17H,4,6-7,10H2,1-3H3/t14-,16+,17-,20+,21-/m1/s1 |
| InChIKey | NLACKICHBSOXFN-ZFCUWQNASA-N |
| XLogP | 3.38 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |