C20H24O4 — CID 143379905
(2S,4aR,6aR,10aS,10bS)-10b-ethenyl-2-(furan-3-yl)-6a-methyl-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-4,10-dione (PubChem CID 143379905) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is (2S,4aR,6aR,10aS,10bS)-10b-ethenyl-2-(furan-3-yl)-6a-methyl-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-4,10-dione.
| Compound Name | (2S,4aR,6aR,10aS,10bS)-10b-ethenyl-2-(furan-3-yl)-6a-methyl-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-4,10-dione |
|---|---|
| PubChem CID | 143379905 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (2S,4aR,6aR,10aS,10bS)-10b-ethenyl-2-(furan-3-yl)-6a-methyl-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-4,10-dione |
| SMILES | C=C[C@]12C[C@@H](c3ccoc3)OC(=O)[C@@H]1CC[C@@]1(C)CCCC(=O)[C@@H]12 |
| InChI | InChI=1S/C20H24O4/c1-3-20-11-16(13-7-10-23-12-13)24-18(22)14(20)6-9-19(2)8-4-5-15(21)17(19)20/h3,7,10,12,14,16-17H,1,4-6,8-9,11H2,2H3/t14-,16-,17-,19+,20-/m0/s1 |
| InChIKey | KHVQGAOUCTVPRF-LPXKSRHMSA-N |
| XLogP | 4.23 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|