C22H26O6 — CID 143379914
methyl (2S,4aR,6aS,7R,10bR)-6a-ethenyl-2-(furan-3-yl)-10b-methyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate (PubChem CID 143379914) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is methyl (2S,4aR,6aS,7R,10bR)-6a-ethenyl-2-(furan-3-yl)-10b-methyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate.
| Compound Name | methyl (2S,4aR,6aS,7R,10bR)-6a-ethenyl-2-(furan-3-yl)-10b-methyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate |
|---|---|
| PubChem CID | 143379914 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | methyl (2S,4aR,6aS,7R,10bR)-6a-ethenyl-2-(furan-3-yl)-10b-methyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate |
| SMILES | C=C[C@@]12CC[C@H]3C(=O)O[C@H](c4ccoc4)C[C@]3(C)C1C(=O)CC[C@H]2C(=O)OC |
| InChI | InChI=1S/C22H26O6/c1-4-22-9-7-14-20(25)28-17(13-8-10-27-12-13)11-21(14,2)18(22)16(23)6-5-15(22)19(24)26-3/h4,8,10,12,14-15,17-18H,1,5-7,9,11H2,2-3H3/t14-,15-,17-,18?,21-,22-/m0/s1 |
| InChIKey | MRCALTMBRVGKMN-RQGIWTARSA-N |
| XLogP | 3.62 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|