C20H30O4 — CID 163060071
(2R,3S,4S,4aS,7S,8S,8aR)-8-[2-(furan-3-yl)ethyl]-4a,7,8-trimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-2,3-diol (PubChem CID 163060071) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (2R,3S,4S,4aS,7S,8S,8aR)-8-[2-(furan-3-yl)ethyl]-4a,7,8-trimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-2,3-diol.
| Compound Name | (2R,3S,4S,4aS,7S,8S,8aR)-8-[2-(furan-3-yl)ethyl]-4a,7,8-trimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-2,3-diol |
|---|---|
| PubChem CID | 163060071 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (2R,3S,4S,4aS,7S,8S,8aR)-8-[2-(furan-3-yl)ethyl]-4a,7,8-trimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-2,3-diol |
| SMILES | C[C@H]1CC[C@@]2(C)[C@H](C[C@@H](O)[C@H](O)[C@@]23CO3)[C@@]1(C)CCc1ccoc1 |
| InChI | InChI=1S/C20H30O4/c1-13-4-8-19(3)16(10-15(21)17(22)20(19)12-24-20)18(13,2)7-5-14-6-9-23-11-14/h6,9,11,13,15-17,21-22H,4-5,7-8,10,12H2,1-3H3/t13-,15+,16+,17-,18-,19-,20-/m0/s1 |
| InChIKey | DORFFLQTHPKFDY-DXFHCHAVSA-N |
| XLogP | 3.17 |
| TPSA | 66.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|