C20H28O4 — CID 162916213
(1R,4S,5S,8R,9S,10R,12R)-9-[2-(furan-3-yl)ethyl]-5-hydroxy-9,10,12-trimethyl-2-oxatricyclo[6.3.1.04,12]dodecan-3-one (PubChem CID 162916213) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (1R,4S,5S,8R,9S,10R,12R)-9-[2-(furan-3-yl)ethyl]-5-hydroxy-9,10,12-trimethyl-2-oxatricyclo[6.3.1.04,12]dodecan-3-one.
| Compound Name | (1R,4S,5S,8R,9S,10R,12R)-9-[2-(furan-3-yl)ethyl]-5-hydroxy-9,10,12-trimethyl-2-oxatricyclo[6.3.1.04,12]dodecan-3-one |
|---|---|
| PubChem CID | 162916213 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (1R,4S,5S,8R,9S,10R,12R)-9-[2-(furan-3-yl)ethyl]-5-hydroxy-9,10,12-trimethyl-2-oxatricyclo[6.3.1.04,12]dodecan-3-one |
| SMILES | C[C@@H]1C[C@H]2OC(=O)[C@@H]3[C@@H](O)CC[C@H]([C@@]1(C)CCc1ccoc1)[C@]32C |
| InChI | InChI=1S/C20H28O4/c1-12-10-16-20(3)15(5-4-14(21)17(20)18(22)24-16)19(12,2)8-6-13-7-9-23-11-13/h7,9,11-12,14-17,21H,4-6,8,10H2,1-3H3/t12-,14+,15-,16-,17+,19+,20+/m1/s1 |
| InChIKey | FRKSRKZPPJMBNA-QQQVCQMJSA-N |
| XLogP | 3.58 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |