C19H24O3 — CID 163070675
(7S,8R,9S,10R)-9-[2-(furan-3-yl)ethyl]-9,10-dimethyl-2-oxatricyclo[6.3.1.04,12]dodeca-1(12),3-dien-7-ol (PubChem CID 163070675) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is (7S,8R,9S,10R)-9-[2-(furan-3-yl)ethyl]-9,10-dimethyl-2-oxatricyclo[6.3.1.04,12]dodeca-1(12),3-dien-7-ol.
| Compound Name | (7S,8R,9S,10R)-9-[2-(furan-3-yl)ethyl]-9,10-dimethyl-2-oxatricyclo[6.3.1.04,12]dodeca-1(12),3-dien-7-ol |
|---|---|
| PubChem CID | 163070675 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (7S,8R,9S,10R)-9-[2-(furan-3-yl)ethyl]-9,10-dimethyl-2-oxatricyclo[6.3.1.04,12]dodeca-1(12),3-dien-7-ol |
| SMILES | C[C@@H]1Cc2occ3c2[C@H]([C@@H](O)CC3)[C@@]1(C)CCc1ccoc1 |
| InChI | InChI=1S/C19H24O3/c1-12-9-16-17-14(11-22-16)3-4-15(20)18(17)19(12,2)7-5-13-6-8-21-10-13/h6,8,10-12,15,18,20H,3-5,7,9H2,1-2H3/t12-,15+,18+,19+/m1/s1 |
| InChIKey | JEUMEIXMPGRZHR-CPIREHHASA-N |
| XLogP | 4.09 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |