C23H40O4 — CID 10738577
2,3-dihydroxypropyl 5-[(1S,2S,4aR)-1,2,5,5-tetramethyl-2,3,4,4a,6,7-hexahydronaphthalen-1-yl]-3-methylpentanoate (PubChem CID 10738577) has the molecular formula C23H40O4 and a molecular weight of 380.57 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 5-[(1S,2S,4aR)-1,2,5,5-tetramethyl-2,3,4,4a,6,7-hexahydronaphthalen-1-yl]-3-methylpentanoate.
| Compound Name | 2,3-dihydroxypropyl 5-[(1S,2S,4aR)-1,2,5,5-tetramethyl-2,3,4,4a,6,7-hexahydronaphthalen-1-yl]-3-methylpentanoate |
|---|---|
| PubChem CID | 10738577 |
| Molecular Formula | C23H40O4 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | 2,3-dihydroxypropyl 5-[(1S,2S,4aR)-1,2,5,5-tetramethyl-2,3,4,4a,6,7-hexahydronaphthalen-1-yl]-3-methylpentanoate |
| SMILES | CC(CC[C@]1(C)C2=CCCC(C)(C)[C@H]2CC[C@@H]1C)CC(=O)OCC(O)CO |
| InChI | InChI=1S/C23H40O4/c1-16(13-21(26)27-15-18(25)14-24)10-12-23(5)17(2)8-9-19-20(23)7-6-11-22(19,3)4/h7,16-19,24-25H,6,8-15H2,1-5H3/t16?,17-,18?,19-,23-/m0/s1 |
| InChIKey | JTMLGRLVXYZNAO-PLOXPRSISA-N |
| XLogP | 4.49 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|