C24H40O5 — CID 163125305
(2-acetyloxy-3-hydroxypropyl) 3-methyl-5-(1,5,5-trimethyl-2,3,4,4a,6,7-hexahydronaphthalen-1-yl)pentanoate (PubChem CID 163125305) has the molecular formula C24H40O5 and a molecular weight of 408.58 g/mol. Its IUPAC name is (2-acetyloxy-3-hydroxypropyl) 3-methyl-5-(1,5,5-trimethyl-2,3,4,4a,6,7-hexahydronaphthalen-1-yl)pentanoate.
| Compound Name | (2-acetyloxy-3-hydroxypropyl) 3-methyl-5-(1,5,5-trimethyl-2,3,4,4a,6,7-hexahydronaphthalen-1-yl)pentanoate |
|---|---|
| PubChem CID | 163125305 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | (2-acetyloxy-3-hydroxypropyl) 3-methyl-5-(1,5,5-trimethyl-2,3,4,4a,6,7-hexahydronaphthalen-1-yl)pentanoate |
| SMILES | CC(=O)OC(CO)COC(=O)CC(C)CCC1(C)CCCC2C1=CCCC2(C)C |
| InChI | InChI=1S/C24H40O5/c1-17(14-22(27)28-16-19(15-25)29-18(2)26)10-13-24(5)12-7-8-20-21(24)9-6-11-23(20,3)4/h9,17,19-20,25H,6-8,10-16H2,1-5H3 |
| InChIKey | DBLFDBTUHOGKHH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|